C25H28N2O4 — CID 156809467
2-[2-[carboxymethyl(methyl)amino]-6-hexylquinolin-4-yl]benzoic acid (PubChem CID 156809467) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[2-[carboxymethyl(methyl)amino]-6-hexylquinolin-4-yl]benzoic acid.
| Compound Name | 2-[2-[carboxymethyl(methyl)amino]-6-hexylquinolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 156809467 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[2-[carboxymethyl(methyl)amino]-6-hexylquinolin-4-yl]benzoic acid |
| SMILES | CCCCCCc1ccc2nc(N(C)CC(=O)O)cc(-c3ccccc3C(=O)O)c2c1 |
| InChI | InChI=1S/C25H28N2O4/c1-3-4-5-6-9-17-12-13-22-21(14-17)20(15-23(26-22)27(2)16-24(28)29)18-10-7-8-11-19(18)25(30)31/h7-8,10-15H,3-6,9,16H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | OHHHPZOCEHGMFV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|