C27H33FN2O2 — CID 156809407
2-[[4-(4-fluorophenyl)-6-hexylquinolin-2-yl]-(2-methylpropyl)amino]acetic acid (PubChem CID 156809407) has the molecular formula C27H33FN2O2 and a molecular weight of 436.57 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-6-hexylquinolin-2-yl]-(2-methylpropyl)amino]acetic acid.
| Compound Name | 2-[[4-(4-fluorophenyl)-6-hexylquinolin-2-yl]-(2-methylpropyl)amino]acetic acid |
|---|---|
| PubChem CID | 156809407 |
| Molecular Formula | C27H33FN2O2 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-6-hexylquinolin-2-yl]-(2-methylpropyl)amino]acetic acid |
| SMILES | CCCCCCc1ccc2nc(N(CC(=O)O)CC(C)C)cc(-c3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C27H33FN2O2/c1-4-5-6-7-8-20-9-14-25-24(15-20)23(21-10-12-22(28)13-11-21)16-26(29-25)30(17-19(2)3)18-27(31)32/h9-16,19H,4-8,17-18H2,1-3H3,(H,31,32) |
| InChIKey | LIBJKCNMQWJQDG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|