C24H27NO2S — CID 178121559
2-methyl-2-(6-pentyl-4-phenylquinolin-2-yl)sulfanylpropanoic acid (PubChem CID 178121559) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is 2-methyl-2-(6-pentyl-4-phenylquinolin-2-yl)sulfanylpropanoic acid.
| Compound Name | 2-methyl-2-(6-pentyl-4-phenylquinolin-2-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 178121559 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-methyl-2-(6-pentyl-4-phenylquinolin-2-yl)sulfanylpropanoic acid |
| SMILES | CCCCCc1ccc2nc(SC(C)(C)C(=O)O)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C24H27NO2S/c1-4-5-7-10-17-13-14-21-20(15-17)19(18-11-8-6-9-12-18)16-22(25-21)28-24(2,3)23(26)27/h6,8-9,11-16H,4-5,7,10H2,1-3H3,(H,26,27) |
| InChIKey | RKTVYDYNTHGMBP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|