C26H30N2O2 — CID 168793922
1-(6-hexyl-4-phenylquinolin-2-yl)pyrrolidine-3-carboxylic acid (PubChem CID 168793922) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-(6-hexyl-4-phenylquinolin-2-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(6-hexyl-4-phenylquinolin-2-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168793922 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1-(6-hexyl-4-phenylquinolin-2-yl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCCCCc1ccc2nc(N3CCC(C(=O)O)C3)cc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C26H30N2O2/c1-2-3-4-6-9-19-12-13-24-23(16-19)22(20-10-7-5-8-11-20)17-25(27-24)28-15-14-21(18-28)26(29)30/h5,7-8,10-13,16-17,21H,2-4,6,9,14-15,18H2,1H3,(H,29,30) |
| InChIKey | NNUMWPOSFDEIHC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|