C20H27NO4 — CID 119354317
1-[4-oxo-4-(4-pentylphenyl)butanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 119354317) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-[4-oxo-4-(4-pentylphenyl)butanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-oxo-4-(4-pentylphenyl)butanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119354317 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[4-oxo-4-(4-pentylphenyl)butanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCCCc1ccc(C(=O)CCC(=O)N2CCC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C20H27NO4/c1-2-3-4-5-15-6-8-16(9-7-15)18(22)10-11-19(23)21-13-12-17(14-21)20(24)25/h6-9,17H,2-5,10-14H2,1H3,(H,24,25) |
| InChIKey | FKHHBVQHFXMJMA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|