C16H20BrNO3 — CID 124700041
(3R)-1-[5-(4-bromophenyl)pentanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 124700041) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is (3R)-1-[5-(4-bromophenyl)pentanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[5-(4-bromophenyl)pentanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124700041 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (3R)-1-[5-(4-bromophenyl)pentanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCN(C(=O)CCCCc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C16H20BrNO3/c17-14-7-5-12(6-8-14)3-1-2-4-15(19)18-10-9-13(11-18)16(20)21/h5-8,13H,1-4,9-11H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | LOOQIEPNVWZCNZ-CYBMUJFWSA-N |
| XLogP | 3.10 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|