C13H16BrNOS — CID 19772140
4-(4-bromophenyl)-1-(1,3-thiazolidin-3-yl)butan-1-one (PubChem CID 19772140) has the molecular formula C13H16BrNOS and a molecular weight of 314.25 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-(1,3-thiazolidin-3-yl)butan-1-one.
| Compound Name | 4-(4-bromophenyl)-1-(1,3-thiazolidin-3-yl)butan-1-one |
|---|---|
| PubChem CID | 19772140 |
| Molecular Formula | C13H16BrNOS |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 4-(4-bromophenyl)-1-(1,3-thiazolidin-3-yl)butan-1-one |
| SMILES | O=C(CCCc1ccc(Br)cc1)N1CCSC1 |
| InChI | InChI=1S/C13H16BrNOS/c14-12-6-4-11(5-7-12)2-1-3-13(16)15-8-9-17-10-15/h4-7H,1-3,8-10H2 |
| InChIKey | PHTDVEGXBUBFRN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |