C14H21ClN4OS — CID 19772109
2-[4-[4-oxo-4-(1,3-thiazolidin-3-yl)butyl]phenyl]guanidine;hydrochloride (PubChem CID 19772109) has the molecular formula C14H21ClN4OS and a molecular weight of 328.87 g/mol. Its IUPAC name is 2-[4-[4-oxo-4-(1,3-thiazolidin-3-yl)butyl]phenyl]guanidine;hydrochloride.
| Compound Name | 2-[4-[4-oxo-4-(1,3-thiazolidin-3-yl)butyl]phenyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 19772109 |
| Molecular Formula | C14H21ClN4OS |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[4-[4-oxo-4-(1,3-thiazolidin-3-yl)butyl]phenyl]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1ccc(CCCC(=O)N2CCSC2)cc1 |
| InChI | InChI=1S/C14H20N4OS.ClH/c15-14(16)17-12-6-4-11(5-7-12)2-1-3-13(19)18-8-9-20-10-18;/h4-7H,1-3,8-10H2,(H4,15,16,17);1H |
| InChIKey | KCQDPWRARMYEKG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|