C10H19NOS — CID 166888281
1-(1,3-thiazolidin-3-yl)heptan-1-one (PubChem CID 166888281) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 1-(1,3-thiazolidin-3-yl)heptan-1-one.
| Compound Name | 1-(1,3-thiazolidin-3-yl)heptan-1-one |
|---|---|
| PubChem CID | 166888281 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-(1,3-thiazolidin-3-yl)heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCSC1 |
| InChI | InChI=1S/C10H19NOS/c1-2-3-4-5-6-10(12)11-7-8-13-9-11/h2-9H2,1H3 |
| InChIKey | APXYSKQEZYKOGY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|