C11H14N2OS — CID 123982868
3-pyridin-4-yl-1-(1,3-thiazolidin-3-yl)propan-1-one (PubChem CID 123982868) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 3-pyridin-4-yl-1-(1,3-thiazolidin-3-yl)propan-1-one.
| Compound Name | 3-pyridin-4-yl-1-(1,3-thiazolidin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 123982868 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-pyridin-4-yl-1-(1,3-thiazolidin-3-yl)propan-1-one |
| SMILES | O=C(CCc1ccncc1)N1CCSC1 |
| InChI | InChI=1S/C11H14N2OS/c14-11(13-7-8-15-9-13)2-1-10-3-5-12-6-4-10/h3-6H,1-2,7-9H2 |
| InChIKey | RQSRWFAQEMJUSG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |