C22H24NO3P — CID 10287244
3-[[4-(2-phenylphenyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 10287244) has the molecular formula C22H24NO3P and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-[[4-(2-phenylphenyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-(2-phenylphenyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 10287244 |
| Molecular Formula | C22H24NO3P |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-[[4-(2-phenylphenyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(-c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24NO3P/c24-27(25,26)16-6-15-23-17-18-11-13-20(14-12-18)22-10-5-4-9-21(22)19-7-2-1-3-8-19/h1-5,7-14,23H,6,15-17H2,(H2,24,25,26) |
| InChIKey | NGDONZQSUFNSSF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|