C24H30N3O4P — CID 118078778
3-[[4-[5-[(Z)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propylphosphonic acid (PubChem CID 118078778) has the molecular formula C24H30N3O4P and a molecular weight of 455.50 g/mol. Its IUPAC name is 3-[[4-[5-[(Z)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[5-[(Z)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 118078778 |
| Molecular Formula | C24H30N3O4P |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[[4-[5-[(Z)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propylphosphonic acid |
| SMILES | CCCC/C(=C/c1nnc(-c2ccc(CNCCCP(=O)(O)O)cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C24H30N3O4P/c1-2-3-8-22(20-9-5-4-6-10-20)17-23-26-27-24(31-23)21-13-11-19(12-14-21)18-25-15-7-16-32(28,29)30/h4-6,9-14,17,25H,2-3,7-8,15-16,18H2,1H3,(H2,28,29,30)/b22-17- |
| InChIKey | YTCRLLJNRFGTCF-XLNRJJMWSA-N |
| XLogP | 5.12 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|