C25H32N3O4P — CID 118078779
3-[[4-[5-[(Z)-2-phenylhept-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propylphosphonic acid (PubChem CID 118078779) has the molecular formula C25H32N3O4P and a molecular weight of 469.52 g/mol. Its IUPAC name is 3-[[4-[5-[(Z)-2-phenylhept-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[5-[(Z)-2-phenylhept-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 118078779 |
| Molecular Formula | C25H32N3O4P |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-[[4-[5-[(Z)-2-phenylhept-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propylphosphonic acid |
| SMILES | CCCCC/C(=C/c1nnc(-c2ccc(CNCCCP(=O)(O)O)cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C25H32N3O4P/c1-2-3-5-11-23(21-9-6-4-7-10-21)18-24-27-28-25(32-24)22-14-12-20(13-15-22)19-26-16-8-17-33(29,30)31/h4,6-7,9-10,12-15,18,26H,2-3,5,8,11,16-17,19H2,1H3,(H2,29,30,31)/b23-18- |
| InChIKey | MVPLSYJCQBUYIO-NKFKGCMQSA-N |
| XLogP | 5.51 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|