C28H29N3O3 — CID 121333805
3-[[4-[5-[(E)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]naphthalen-1-yl]methylamino]propanoic acid (PubChem CID 121333805) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[[4-[5-[(E)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]naphthalen-1-yl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[5-[(E)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]naphthalen-1-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 121333805 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-[[4-[5-[(E)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]naphthalen-1-yl]methylamino]propanoic acid |
| SMILES | CCCC/C(=C\c1nnc(-c2ccc(CNCCC(=O)O)c3ccccc23)o1)c1ccccc1 |
| InChI | InChI=1S/C28H29N3O3/c1-2-3-9-21(20-10-5-4-6-11-20)18-26-30-31-28(34-26)25-15-14-22(19-29-17-16-27(32)33)23-12-7-8-13-24(23)25/h4-8,10-15,18,29H,2-3,9,16-17,19H2,1H3,(H,32,33)/b21-18+ |
| InChIKey | GNTFPUGAJCLGEP-DYTRJAOYSA-N |
| XLogP | 6.18 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|