C24H27N3O3 — CID 118078782
3-[[4-[5-[(E)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propanoic acid (PubChem CID 118078782) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-[[4-[5-[(E)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[5-[(E)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 118078782 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-[[4-[5-[(E)-2-phenylhex-1-enyl]-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propanoic acid |
| SMILES | CCCC/C(=C\c1nnc(-c2ccc(CNCCC(=O)O)cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-3-7-21(19-8-5-4-6-9-19)16-22-26-27-24(30-22)20-12-10-18(11-13-20)17-25-15-14-23(28)29/h4-6,8-13,16,25H,2-3,7,14-15,17H2,1H3,(H,28,29)/b21-16+ |
| InChIKey | QWUFWQHCEBLKDL-LTGZKZEYSA-N |
| XLogP | 5.03 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|