C25H29N3O3 — CID 123208538
3-[[4-[5-(2-phenylhept-1-enyl)-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propanoic acid (PubChem CID 123208538) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-[[4-[5-(2-phenylhept-1-enyl)-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[5-(2-phenylhept-1-enyl)-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 123208538 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-[[4-[5-(2-phenylhept-1-enyl)-1,3,4-oxadiazol-2-yl]phenyl]methylamino]propanoic acid |
| SMILES | CCCCCC(=Cc1nnc(-c2ccc(CNCCC(=O)O)cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O3/c1-2-3-5-10-22(20-8-6-4-7-9-20)17-23-27-28-25(31-23)21-13-11-19(12-14-21)18-26-16-15-24(29)30/h4,6-9,11-14,17,26H,2-3,5,10,15-16,18H2,1H3,(H,29,30) |
| InChIKey | NJBABLGRNLSVAK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|