C26H38NO3P — CID 78323292
3-[[4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 78323292) has the molecular formula C26H38NO3P and a molecular weight of 443.57 g/mol. Its IUPAC name is 3-[[4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78323292 |
| Molecular Formula | C26H38NO3P |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 3-[[4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(CCCCCC2(c3ccccc3)CCCC2)cc1 |
| InChI | InChI=1S/C26H38NO3P/c28-31(29,30)21-9-20-27-22-24-15-13-23(14-16-24)10-3-2-6-17-26(18-7-8-19-26)25-11-4-1-5-12-25/h1,4-5,11-16,27H,2-3,6-10,17-22H2,(H2,28,29,30) |
| InChIKey | IMJLXORVOPGUCR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|