C26H36ClNO3P+ — CID 90399587
3-[[3-chloro-4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90399587) has the molecular formula C26H36ClNO3P+ and a molecular weight of 477.01 g/mol. Its IUPAC name is 3-[[3-chloro-4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[3-chloro-4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90399587 |
| Molecular Formula | C26H36ClNO3P+ |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 3-[[3-chloro-4-[5-(1-phenylcyclopentyl)pentyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1ccc(CCCCCC2(c3ccccc3)CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C26H35ClNO3P/c27-25-20-22(21-28-18-9-19-31-32(29)30)13-14-23(25)10-3-2-6-15-26(16-7-8-17-26)24-11-4-1-5-12-24/h1,4-5,11-14,20,28H,2-3,6-10,15-19,21H2/p+1 |
| InChIKey | MBRISODKJKXJKM-UHFFFAOYSA-O |
| XLogP | 7.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|