C25H31NO4P+ — CID 70914148
hydroxy-[3-[[4-[4-(3-methoxyphenyl)butyl]naphthalen-1-yl]methylamino]propoxy]-oxophosphanium (PubChem CID 70914148) has the molecular formula C25H31NO4P+ and a molecular weight of 440.50 g/mol. Its IUPAC name is hydroxy-[3-[[4-[4-(3-methoxyphenyl)butyl]naphthalen-1-yl]methylamino]propoxy]-oxophosphanium.
| Compound Name | hydroxy-[3-[[4-[4-(3-methoxyphenyl)butyl]naphthalen-1-yl]methylamino]propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 70914148 |
| Molecular Formula | C25H31NO4P+ |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | hydroxy-[3-[[4-[4-(3-methoxyphenyl)butyl]naphthalen-1-yl]methylamino]propoxy]-oxophosphanium |
| SMILES | COc1cccc(CCCCc2ccc(CNCCCO[P+](=O)O)c3ccccc23)c1 |
| InChI | InChI=1S/C25H30NO4P/c1-29-23-11-6-9-20(18-23)8-2-3-10-21-14-15-22(25-13-5-4-12-24(21)25)19-26-16-7-17-30-31(27)28/h4-6,9,11-15,18,26H,2-3,7-8,10,16-17,19H2,1H3/p+1 |
| InChIKey | KCGHFJFFYFOWST-UHFFFAOYSA-O |
| XLogP | 5.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|