C24H32F2N2O3PS+ — CID 90227500
3-[[4-fluoro-5-[4-[1-(4-fluorophenyl)cyclopentyl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90227500) has the molecular formula C24H32F2N2O3PS+ and a molecular weight of 497.57 g/mol. Its IUPAC name is 3-[[4-fluoro-5-[4-[1-(4-fluorophenyl)cyclopentyl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[4-fluoro-5-[4-[1-(4-fluorophenyl)cyclopentyl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90227500 |
| Molecular Formula | C24H32F2N2O3PS+ |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 3-[[4-fluoro-5-[4-[1-(4-fluorophenyl)cyclopentyl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1cc(F)c(SCCCCC2(c3ccc(F)cc3)CCCC2)cn1 |
| InChI | InChI=1S/C24H31F2N2O3PS/c25-20-8-6-19(7-9-20)24(10-1-2-11-24)12-3-4-15-33-23-18-28-21(16-22(23)26)17-27-13-5-14-31-32(29)30/h6-9,16,18,27H,1-5,10-15,17H2/p+1 |
| InChIKey | FDCRZSFXPZUHJH-UHFFFAOYSA-O |
| XLogP | 6.28 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|