C20H27F2N2O3PS — CID 90218748
3-[[4-fluoro-5-[5-(4-fluorophenyl)pentylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid (PubChem CID 90218748) has the molecular formula C20H27F2N2O3PS and a molecular weight of 444.48 g/mol. Its IUPAC name is 3-[[4-fluoro-5-[5-(4-fluorophenyl)pentylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-fluoro-5-[5-(4-fluorophenyl)pentylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218748 |
| Molecular Formula | C20H27F2N2O3PS |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 3-[[4-fluoro-5-[5-(4-fluorophenyl)pentylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(SCCCCCc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C20H27F2N2O3PS/c21-17-8-6-16(7-9-17)5-2-1-3-12-29-20-15-24-18(13-19(20)22)14-23-10-4-11-28(25,26)27/h6-9,13,15,23H,1-5,10-12,14H2,(H2,25,26,27) |
| InChIKey | AVHIVDNMWBIBLB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|