C25H34F2N2O3PS+ — CID 90227495
3-[[4-fluoro-5-[4-[1-(2-fluorophenyl)cyclohexyl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90227495) has the molecular formula C25H34F2N2O3PS+ and a molecular weight of 511.60 g/mol. Its IUPAC name is 3-[[4-fluoro-5-[4-[1-(2-fluorophenyl)cyclohexyl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[4-fluoro-5-[4-[1-(2-fluorophenyl)cyclohexyl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90227495 |
| Molecular Formula | C25H34F2N2O3PS+ |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 3-[[4-fluoro-5-[4-[1-(2-fluorophenyl)cyclohexyl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1cc(F)c(SCCCCC2(c3ccccc3F)CCCCC2)cn1 |
| InChI | InChI=1S/C25H33F2N2O3PS/c26-22-10-3-2-9-21(22)25(11-4-1-5-12-25)13-6-7-16-34-24-19-29-20(17-23(24)27)18-28-14-8-15-32-33(30)31/h2-3,9-10,17,19,28H,1,4-8,11-16,18H2/p+1 |
| InChIKey | BQRCYYXFBVIAOM-UHFFFAOYSA-O |
| XLogP | 6.67 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|