C24H29F4NO5PS+ — CID 90227496
3-[[4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-3-(trifluoromethoxy)phenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90227496) has the molecular formula C24H29F4NO5PS+ and a molecular weight of 550.53 g/mol. Its IUPAC name is 3-[[4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-3-(trifluoromethoxy)phenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-3-(trifluoromethoxy)phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90227496 |
| Molecular Formula | C24H29F4NO5PS+ |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 3-[[4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-3-(trifluoromethoxy)phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1ccc(SCCCCC2(c3ccccc3F)COC2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H28F4NO5PS/c25-20-7-2-1-6-19(20)23(16-32-17-23)10-3-4-13-36-22-9-8-18(14-21(22)34-24(26,27)28)15-29-11-5-12-33-35(30)31/h1-2,6-9,14,29H,3-5,10-13,15-17H2/p+1 |
| InChIKey | XEVVQGXSKUHWPT-UHFFFAOYSA-O |
| XLogP | 6.10 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|