C22H27ClF3NO3PS+ — CID 90227462
3-[[4-[5-(4-chlorophenyl)pentylsulfanyl]-3-(trifluoromethyl)phenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90227462) has the molecular formula C22H27ClF3NO3PS+ and a molecular weight of 508.95 g/mol. Its IUPAC name is 3-[[4-[5-(4-chlorophenyl)pentylsulfanyl]-3-(trifluoromethyl)phenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[4-[5-(4-chlorophenyl)pentylsulfanyl]-3-(trifluoromethyl)phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90227462 |
| Molecular Formula | C22H27ClF3NO3PS+ |
| Molecular Weight | 508.95 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 3-[[4-[5-(4-chlorophenyl)pentylsulfanyl]-3-(trifluoromethyl)phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1ccc(SCCCCCc2ccc(Cl)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H26ClF3NO3PS/c23-19-9-6-17(7-10-19)5-2-1-3-14-32-21-11-8-18(15-20(21)22(24,25)26)16-27-12-4-13-30-31(28)29/h6-11,15,27H,1-5,12-14,16H2/p+1 |
| InChIKey | JAAPEGBVGJFQQN-UHFFFAOYSA-O |
| XLogP | 7.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.95 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|