C22H31FN2O3P+ — CID 90399620
3-[[4-[5-(4-fluorophenyl)pentylamino]-3-methylphenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90399620) has the molecular formula C22H31FN2O3P+ and a molecular weight of 421.47 g/mol. Its IUPAC name is 3-[[4-[5-(4-fluorophenyl)pentylamino]-3-methylphenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[4-[5-(4-fluorophenyl)pentylamino]-3-methylphenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90399620 |
| Molecular Formula | C22H31FN2O3P+ |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3-[[4-[5-(4-fluorophenyl)pentylamino]-3-methylphenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | Cc1cc(CNCCCO[P+](=O)O)ccc1NCCCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H30FN2O3P/c1-18-16-20(17-24-13-5-15-28-29(26)27)9-12-22(18)25-14-4-2-3-6-19-7-10-21(23)11-8-19/h7-12,16,24-25H,2-6,13-15,17H2,1H3/p+1 |
| InChIKey | AAXFFILJNNWKLW-UHFFFAOYSA-O |
| XLogP | 5.11 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|