C23H31F2NO3PS+ — CID 90227450
3-[[3-fluoro-4-[5-(4-fluorophenyl)-5-methylhexyl]sulfanylphenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90227450) has the molecular formula C23H31F2NO3PS+ and a molecular weight of 470.54 g/mol. Its IUPAC name is 3-[[3-fluoro-4-[5-(4-fluorophenyl)-5-methylhexyl]sulfanylphenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[3-fluoro-4-[5-(4-fluorophenyl)-5-methylhexyl]sulfanylphenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90227450 |
| Molecular Formula | C23H31F2NO3PS+ |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 3-[[3-fluoro-4-[5-(4-fluorophenyl)-5-methylhexyl]sulfanylphenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | CC(C)(CCCCSc1ccc(CNCCCO[P+](=O)O)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H30F2NO3PS/c1-23(2,19-7-9-20(24)10-8-19)12-3-4-15-31-22-11-6-18(16-21(22)25)17-26-13-5-14-29-30(27)28/h6-11,16,26H,3-5,12-15,17H2,1-2H3/p+1 |
| InChIKey | HCBHDMSPQLLKDU-UHFFFAOYSA-O |
| XLogP | 6.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|