C21H28ClFN2O3P+ — CID 90401215
3-[[3-chloro-4-[5-(4-fluorophenyl)pentylamino]phenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90401215) has the molecular formula C21H28ClFN2O3P+ and a molecular weight of 441.89 g/mol. Its IUPAC name is 3-[[3-chloro-4-[5-(4-fluorophenyl)pentylamino]phenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[3-chloro-4-[5-(4-fluorophenyl)pentylamino]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90401215 |
| Molecular Formula | C21H28ClFN2O3P+ |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-[[3-chloro-4-[5-(4-fluorophenyl)pentylamino]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1ccc(NCCCCCc2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H27ClFN2O3P/c22-20-15-18(16-24-12-4-14-28-29(26)27)8-11-21(20)25-13-3-1-2-5-17-6-9-19(23)10-7-17/h6-11,15,24-25H,1-5,12-14,16H2/p+1 |
| InChIKey | RPAVVTYIFCWADP-UHFFFAOYSA-O |
| XLogP | 5.45 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|