C23H31F2NO3P+ — CID 90399576
3-[[5-fluoro-4-[6-(4-fluorophenyl)hexyl]-2-methylphenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90399576) has the molecular formula C23H31F2NO3P+ and a molecular weight of 438.48 g/mol. Its IUPAC name is 3-[[5-fluoro-4-[6-(4-fluorophenyl)hexyl]-2-methylphenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[5-fluoro-4-[6-(4-fluorophenyl)hexyl]-2-methylphenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90399576 |
| Molecular Formula | C23H31F2NO3P+ |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-[[5-fluoro-4-[6-(4-fluorophenyl)hexyl]-2-methylphenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | Cc1cc(CCCCCCc2ccc(F)cc2)c(F)cc1CNCCCO[P+](=O)O |
| InChI | InChI=1S/C23H30F2NO3P/c1-18-15-20(8-5-3-2-4-7-19-9-11-22(24)12-10-19)23(25)16-21(18)17-26-13-6-14-29-30(27)28/h9-12,15-16,26H,2-8,13-14,17H2,1H3/p+1 |
| InChIKey | OBWYJRZVKYUQEJ-UHFFFAOYSA-O |
| XLogP | 5.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|