C23H28F3NO4PS+ — CID 90227780
3-[[2,5-difluoro-4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90227780) has the molecular formula C23H28F3NO4PS+ and a molecular weight of 502.52 g/mol. Its IUPAC name is 3-[[2,5-difluoro-4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[2,5-difluoro-4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90227780 |
| Molecular Formula | C23H28F3NO4PS+ |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 3-[[2,5-difluoro-4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1cc(F)c(SCCCCC2(c3ccccc3F)COC2)cc1F |
| InChI | InChI=1S/C23H27F3NO4PS/c24-19-7-2-1-6-18(19)23(15-30-16-23)8-3-4-11-33-22-13-20(25)17(12-21(22)26)14-27-9-5-10-31-32(28)29/h1-2,6-7,12-13,27H,3-5,8-11,14-16H2/p+1 |
| InChIKey | FLLIFGOTOUKMGK-UHFFFAOYSA-O |
| XLogP | 5.48 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|