C44H54F4N4O5PS2+ — CID 90220405
bis[3-[[4-fluoro-5-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy]-oxophosphanium (PubChem CID 90220405) has the molecular formula C44H54F4N4O5PS2+ and a molecular weight of 890.04 g/mol. Its IUPAC name is bis[3-[[4-fluoro-5-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy]-oxophosphanium.
| Compound Name | bis[3-[[4-fluoro-5-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 90220405 |
| Molecular Formula | C44H54F4N4O5PS2+ |
| Molecular Weight | 890.04 g/mol |
| Exact Mass | 889.32 |
| IUPAC Name | bis[3-[[4-fluoro-5-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]-2-pyridinyl]methylamino]propoxy]-oxophosphanium |
| SMILES | O=[P+](OCCCNCc1cc(F)c(SCCCCC2(c3ccccc3F)COC2)cn1)OCCCNCc1cc(F)c(SCCCCC2(c3ccccc3F)COC2)cn1 |
| InChI | InChI=1S/C44H54F4N4O5PS2/c45-37-13-3-1-11-35(37)43(29-54-30-43)15-5-7-21-59-41-27-51-33(23-39(41)47)25-49-17-9-19-56-58(53)57-20-10-18-50-26-34-24-40(48)42(28-52-34)60-22-8-6-16-44(31-55-32-44)36-12-2-4-14-38(36)46/h1-4,11-14,23-24,27-28,49-50H,5-10,15-22,25-26,29-32H2/q+1 |
| InChIKey | TYUMLWRNJJZBMK-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.04 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|