C23H29F2NO4PS+ — CID 90227899
3-[[2,5-difluoro-4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90227899) has the molecular formula C23H29F2NO4PS+ and a molecular weight of 484.53 g/mol. Its IUPAC name is 3-[[2,5-difluoro-4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[2,5-difluoro-4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90227899 |
| Molecular Formula | C23H29F2NO4PS+ |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-[[2,5-difluoro-4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1cc(F)c(SCCCCC2(c3ccccc3)COC2)cc1F |
| InChI | InChI=1S/C23H28F2NO4PS/c24-20-14-22(21(25)13-18(20)15-26-10-6-11-30-31(27)28)32-12-5-4-9-23(16-29-17-23)19-7-2-1-3-8-19/h1-3,7-8,13-14,26H,4-6,9-12,15-17H2/p+1 |
| InChIKey | SPWNPJDVPQNZJX-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|