C24H31F3NO5PS — CID 90218654
3-[[4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]-3-(trifluoromethoxy)phenyl]methylamino]propylphosphonic acid (PubChem CID 90218654) has the molecular formula C24H31F3NO5PS and a molecular weight of 533.55 g/mol. Its IUPAC name is 3-[[4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]-3-(trifluoromethoxy)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]-3-(trifluoromethoxy)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218654 |
| Molecular Formula | C24H31F3NO5PS |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 3-[[4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]-3-(trifluoromethoxy)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(SCCCCC2(c3ccccc3)COC2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H31F3NO5PS/c25-24(26,27)33-21-15-19(16-28-12-6-13-34(29,30)31)9-10-22(21)35-14-5-4-11-23(17-32-18-23)20-7-2-1-3-8-20/h1-3,7-10,15,28H,4-6,11-14,16-18H2,(H2,29,30,31) |
| InChIKey | KVOSIQOBDCBRNG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|