C28H38F5N2O3P — CID 78320469
3-[[3-(1,1,2,2,2-pentafluoroethyl)-4-[4-(1-phenylcyclohexyl)butylamino]phenyl]methylamino]propylphosphonic acid (PubChem CID 78320469) has the molecular formula C28H38F5N2O3P and a molecular weight of 576.59 g/mol. Its IUPAC name is 3-[[3-(1,1,2,2,2-pentafluoroethyl)-4-[4-(1-phenylcyclohexyl)butylamino]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-(1,1,2,2,2-pentafluoroethyl)-4-[4-(1-phenylcyclohexyl)butylamino]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78320469 |
| Molecular Formula | C28H38F5N2O3P |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 3-[[3-(1,1,2,2,2-pentafluoroethyl)-4-[4-(1-phenylcyclohexyl)butylamino]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(NCCCCC2(c3ccccc3)CCCCC2)c(C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C28H38F5N2O3P/c29-27(30,28(31,32)33)24-20-22(21-34-17-9-19-39(36,37)38)12-13-25(24)35-18-8-7-16-26(14-5-2-6-15-26)23-10-3-1-4-11-23/h1,3-4,10-13,20,34-35H,2,5-9,14-19,21H2,(H2,36,37,38) |
| InChIKey | LKIHSLQBUOYXCC-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|