C25H33F5NO3P — CID 78324859
3-[[4-[6-(4-methylphenyl)hexyl]-3-(1,1,2,2,2-pentafluoroethyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 78324859) has the molecular formula C25H33F5NO3P and a molecular weight of 521.51 g/mol. Its IUPAC name is 3-[[4-[6-(4-methylphenyl)hexyl]-3-(1,1,2,2,2-pentafluoroethyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[6-(4-methylphenyl)hexyl]-3-(1,1,2,2,2-pentafluoroethyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78324859 |
| Molecular Formula | C25H33F5NO3P |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 3-[[4-[6-(4-methylphenyl)hexyl]-3-(1,1,2,2,2-pentafluoroethyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1ccc(CCCCCCc2ccc(CNCCCP(=O)(O)O)cc2C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H33F5NO3P/c1-19-9-11-20(12-10-19)7-4-2-3-5-8-22-14-13-21(18-31-15-6-16-35(32,33)34)17-23(22)24(26,27)25(28,29)30/h9-14,17,31H,2-8,15-16,18H2,1H3,(H2,32,33,34) |
| InChIKey | VJZODZFTAXNUCA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|