C22H30ClFNO3P — CID 78322356
3-[[5-chloro-2-fluoro-4-(6-phenylhexyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 78322356) has the molecular formula C22H30ClFNO3P and a molecular weight of 441.91 g/mol. Its IUPAC name is 3-[[5-chloro-2-fluoro-4-(6-phenylhexyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[5-chloro-2-fluoro-4-(6-phenylhexyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78322356 |
| Molecular Formula | C22H30ClFNO3P |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-[[5-chloro-2-fluoro-4-(6-phenylhexyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(Cl)c(CCCCCCc2ccccc2)cc1F |
| InChI | InChI=1S/C22H30ClFNO3P/c23-21-15-20(17-25-13-8-14-29(26,27)28)22(24)16-19(21)12-7-2-1-4-9-18-10-5-3-6-11-18/h3,5-6,10-11,15-16,25H,1-2,4,7-9,12-14,17H2,(H2,26,27,28) |
| InChIKey | PVSRNWNEVGIQBA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|