C25H31FNO4PS — CID 53232998
3-[[3-(5-fluorothiophen-2-yl)-5-(5-phenylpentoxy)phenyl]methylamino]propylphosphonic acid (PubChem CID 53232998) has the molecular formula C25H31FNO4PS and a molecular weight of 491.57 g/mol. Its IUPAC name is 3-[[3-(5-fluorothiophen-2-yl)-5-(5-phenylpentoxy)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-(5-fluorothiophen-2-yl)-5-(5-phenylpentoxy)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 53232998 |
| Molecular Formula | C25H31FNO4PS |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 3-[[3-(5-fluorothiophen-2-yl)-5-(5-phenylpentoxy)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(OCCCCCc2ccccc2)cc(-c2ccc(F)s2)c1 |
| InChI | InChI=1S/C25H31FNO4PS/c26-25-12-11-24(33-25)22-16-21(19-27-13-7-15-32(28,29)30)17-23(18-22)31-14-6-2-5-10-20-8-3-1-4-9-20/h1,3-4,8-9,11-12,16-18,27H,2,5-7,10,13-15,19H2,(H2,28,29,30) |
| InChIKey | SNJUAKSZEWTECQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|