C26H34NO6P — CID 71599560
3-[[3-(furan-2-yl)-4-[5-(3-methoxyphenyl)pentoxy]phenyl]methylamino]propylphosphonic acid (PubChem CID 71599560) has the molecular formula C26H34NO6P and a molecular weight of 487.53 g/mol. Its IUPAC name is 3-[[3-(furan-2-yl)-4-[5-(3-methoxyphenyl)pentoxy]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-(furan-2-yl)-4-[5-(3-methoxyphenyl)pentoxy]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 71599560 |
| Molecular Formula | C26H34NO6P |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 3-[[3-(furan-2-yl)-4-[5-(3-methoxyphenyl)pentoxy]phenyl]methylamino]propylphosphonic acid |
| SMILES | COc1cccc(CCCCCOc2ccc(CNCCCP(=O)(O)O)cc2-c2ccco2)c1 |
| InChI | InChI=1S/C26H34NO6P/c1-31-23-10-5-9-21(18-23)8-3-2-4-15-32-26-13-12-22(19-24(26)25-11-6-16-33-25)20-27-14-7-17-34(28,29)30/h5-6,9-13,16,18-19,27H,2-4,7-8,14-15,17,20H2,1H3,(H2,28,29,30) |
| InChIKey | OLUQNJJITJQBOE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|