C27H35FNO5P — CID 71599220
3-[[4-[3-[3-fluoro-4-(2-methylpropyl)phenyl]propoxy]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid (PubChem CID 71599220) has the molecular formula C27H35FNO5P and a molecular weight of 503.55 g/mol. Its IUPAC name is 3-[[4-[3-[3-fluoro-4-(2-methylpropyl)phenyl]propoxy]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[3-[3-fluoro-4-(2-methylpropyl)phenyl]propoxy]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 71599220 |
| Molecular Formula | C27H35FNO5P |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 3-[[4-[3-[3-fluoro-4-(2-methylpropyl)phenyl]propoxy]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid |
| SMILES | CC(C)Cc1ccc(CCCOc2ccc(CNCCCP(=O)(O)O)cc2-c2ccco2)cc1F |
| InChI | InChI=1S/C27H35FNO5P/c1-20(2)16-23-10-8-21(18-25(23)28)6-3-13-34-27-11-9-22(17-24(27)26-7-4-14-33-26)19-29-12-5-15-35(30,31)32/h4,7-11,14,17-18,20,29H,3,5-6,12-13,15-16,19H2,1-2H3,(H2,30,31,32) |
| InChIKey | FKNPNFMKHRHTST-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|