C27H27FNO4P — CID 44553757
3-[[3-fluoro-4-[5-(1-phenylcyclopropyl)-1-benzofuran-2-yl]phenyl]methylamino]propylphosphonic acid (PubChem CID 44553757) has the molecular formula C27H27FNO4P and a molecular weight of 479.49 g/mol. Its IUPAC name is 3-[[3-fluoro-4-[5-(1-phenylcyclopropyl)-1-benzofuran-2-yl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-fluoro-4-[5-(1-phenylcyclopropyl)-1-benzofuran-2-yl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 44553757 |
| Molecular Formula | C27H27FNO4P |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 3-[[3-fluoro-4-[5-(1-phenylcyclopropyl)-1-benzofuran-2-yl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(-c2cc3cc(C4(c5ccccc5)CC4)ccc3o2)c(F)c1 |
| InChI | InChI=1S/C27H27FNO4P/c28-24-15-19(18-29-13-4-14-34(30,31)32)7-9-23(24)26-17-20-16-22(8-10-25(20)33-26)27(11-12-27)21-5-2-1-3-6-21/h1-3,5-10,15-17,29H,4,11-14,18H2,(H2,30,31,32) |
| InChIKey | MCSNTLJFGTZWDA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|