C25H30F2NO5P — CID 71598672
3-[[2-fluoro-4-[5-(4-fluorophenyl)pentoxy]-5-(furan-3-yl)phenyl]methylamino]propylphosphonic acid (PubChem CID 71598672) has the molecular formula C25H30F2NO5P and a molecular weight of 493.49 g/mol. Its IUPAC name is 3-[[2-fluoro-4-[5-(4-fluorophenyl)pentoxy]-5-(furan-3-yl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2-fluoro-4-[5-(4-fluorophenyl)pentoxy]-5-(furan-3-yl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 71598672 |
| Molecular Formula | C25H30F2NO5P |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 3-[[2-fluoro-4-[5-(4-fluorophenyl)pentoxy]-5-(furan-3-yl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(-c2ccoc2)c(OCCCCCc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C25H30F2NO5P/c26-22-8-6-19(7-9-22)5-2-1-3-12-33-25-16-24(27)21(15-23(25)20-10-13-32-18-20)17-28-11-4-14-34(29,30)31/h6-10,13,15-16,18,28H,1-5,11-12,14,17H2,(H2,29,30,31) |
| InChIKey | LFJIILJOOYRBRD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|