C26H33FNO6P — CID 71598947
3-[[4-[3-(3-fluoro-4-propan-2-yloxyphenyl)propoxy]-3-(furan-3-yl)phenyl]methylamino]propylphosphonic acid (PubChem CID 71598947) has the molecular formula C26H33FNO6P and a molecular weight of 505.52 g/mol. Its IUPAC name is 3-[[4-[3-(3-fluoro-4-propan-2-yloxyphenyl)propoxy]-3-(furan-3-yl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[3-(3-fluoro-4-propan-2-yloxyphenyl)propoxy]-3-(furan-3-yl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 71598947 |
| Molecular Formula | C26H33FNO6P |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 3-[[4-[3-(3-fluoro-4-propan-2-yloxyphenyl)propoxy]-3-(furan-3-yl)phenyl]methylamino]propylphosphonic acid |
| SMILES | CC(C)Oc1ccc(CCCOc2ccc(CNCCCP(=O)(O)O)cc2-c2ccoc2)cc1F |
| InChI | InChI=1S/C26H33FNO6P/c1-19(2)34-26-9-6-20(16-24(26)27)5-3-12-33-25-8-7-21(15-23(25)22-10-13-32-18-22)17-28-11-4-14-35(29,30)31/h6-10,13,15-16,18-19,28H,3-5,11-12,14,17H2,1-2H3,(H2,29,30,31) |
| InChIKey | QESRWKRZFPWLIV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|