C52H58F6N2O7P+ — CID 90181603
bis[3-[[3-(furan-2-yl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]methylamino]propoxy]-oxophosphanium (PubChem CID 90181603) has the molecular formula C52H58F6N2O7P+ and a molecular weight of 968.00 g/mol. Its IUPAC name is bis[3-[[3-(furan-2-yl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]methylamino]propoxy]-oxophosphanium.
| Compound Name | bis[3-[[3-(furan-2-yl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]methylamino]propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 90181603 |
| Molecular Formula | C52H58F6N2O7P+ |
| Molecular Weight | 968.00 g/mol |
| Exact Mass | 967.39 |
| IUPAC Name | bis[3-[[3-(furan-2-yl)-4-[5-[3-(trifluoromethyl)phenyl]pentoxy]phenyl]methylamino]propoxy]-oxophosphanium |
| SMILES | O=[P+](OCCCNCc1ccc(OCCCCCc2cccc(C(F)(F)F)c2)c(-c2ccco2)c1)OCCCNCc1ccc(OCCCCCc2cccc(C(F)(F)F)c2)c(-c2ccco2)c1 |
| InChI | InChI=1S/C52H58F6N2O7P/c53-51(54,55)43-17-7-15-39(33-43)13-3-1-5-27-62-49-23-21-41(35-45(49)47-19-9-29-64-47)37-59-25-11-31-66-68(61)67-32-12-26-60-38-42-22-24-50(46(36-42)48-20-10-30-65-48)63-28-6-2-4-14-40-16-8-18-44(34-40)52(56,57)58/h7-10,15-24,29-30,33-36,59-60H,1-6,11-14,25-28,31-32,37-38H2/q+1 |
| InChIKey | NCRPYOHQYBKUPF-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.00 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|