C26H34NO5P — CID 71599731
4-[[3-(furan-2-yl)-4-(5-phenylpentoxy)phenyl]methylamino]butan-2-ylphosphonic acid (PubChem CID 71599731) has the molecular formula C26H34NO5P and a molecular weight of 471.53 g/mol. Its IUPAC name is 4-[[3-(furan-2-yl)-4-(5-phenylpentoxy)phenyl]methylamino]butan-2-ylphosphonic acid.
| Compound Name | 4-[[3-(furan-2-yl)-4-(5-phenylpentoxy)phenyl]methylamino]butan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 71599731 |
| Molecular Formula | C26H34NO5P |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-[[3-(furan-2-yl)-4-(5-phenylpentoxy)phenyl]methylamino]butan-2-ylphosphonic acid |
| SMILES | CC(CCNCc1ccc(OCCCCCc2ccccc2)c(-c2ccco2)c1)P(=O)(O)O |
| InChI | InChI=1S/C26H34NO5P/c1-21(33(28,29)30)15-16-27-20-23-13-14-26(24(19-23)25-12-8-18-32-25)31-17-7-3-6-11-22-9-4-2-5-10-22/h2,4-5,8-10,12-14,18-19,21,27H,3,6-7,11,15-17,20H2,1H3,(H2,28,29,30) |
| InChIKey | IXHIAAUHCQDHBW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|