C25H31ClNO5P — CID 71599734
3-[[4-[5-(3-chlorophenyl)pentoxy]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid (PubChem CID 71599734) has the molecular formula C25H31ClNO5P and a molecular weight of 491.95 g/mol. Its IUPAC name is 3-[[4-[5-(3-chlorophenyl)pentoxy]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[5-(3-chlorophenyl)pentoxy]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 71599734 |
| Molecular Formula | C25H31ClNO5P |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-[[4-[5-(3-chlorophenyl)pentoxy]-3-(furan-2-yl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(OCCCCCc2cccc(Cl)c2)c(-c2ccco2)c1 |
| InChI | InChI=1S/C25H31ClNO5P/c26-22-9-4-8-20(17-22)7-2-1-3-14-31-25-12-11-21(18-23(25)24-10-5-15-32-24)19-27-13-6-16-33(28,29)30/h4-5,8-12,15,17-18,27H,1-3,6-7,13-14,16,19H2,(H2,28,29,30) |
| InChIKey | KHQKHOYZEVSYQE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|