C27H39ClNO3P — CID 78324241
3-[[3-chloro-4-[5-(1-phenylcyclohexyl)pentyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 78324241) has the molecular formula C27H39ClNO3P and a molecular weight of 492.04 g/mol. Its IUPAC name is 3-[[3-chloro-4-[5-(1-phenylcyclohexyl)pentyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-chloro-4-[5-(1-phenylcyclohexyl)pentyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78324241 |
| Molecular Formula | C27H39ClNO3P |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 3-[[3-chloro-4-[5-(1-phenylcyclohexyl)pentyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(CCCCCC2(c3ccccc3)CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C27H39ClNO3P/c28-26-21-23(22-29-19-10-20-33(30,31)32)14-15-24(26)11-4-2-7-16-27(17-8-3-9-18-27)25-12-5-1-6-13-25/h1,5-6,12-15,21,29H,2-4,7-11,16-20,22H2,(H2,30,31,32) |
| InChIKey | RZXXRHYFIPYHKB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|