C28H39F3NO4P — CID 78324857
3-[[4-[5-(1-phenylcyclohexyl)pentyl]-3-(trifluoromethoxy)phenyl]methylamino]propylphosphonic acid (PubChem CID 78324857) has the molecular formula C28H39F3NO4P and a molecular weight of 541.59 g/mol. Its IUPAC name is 3-[[4-[5-(1-phenylcyclohexyl)pentyl]-3-(trifluoromethoxy)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[5-(1-phenylcyclohexyl)pentyl]-3-(trifluoromethoxy)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 78324857 |
| Molecular Formula | C28H39F3NO4P |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 3-[[4-[5-(1-phenylcyclohexyl)pentyl]-3-(trifluoromethoxy)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(CCCCCC2(c3ccccc3)CCCCC2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C28H39F3NO4P/c29-28(30,31)36-26-21-23(22-32-19-10-20-37(33,34)35)14-15-24(26)11-4-2-7-16-27(17-8-3-9-18-27)25-12-5-1-6-13-25/h1,5-6,12-15,21,32H,2-4,7-11,16-20,22H2,(H2,33,34,35) |
| InChIKey | UGDIGBVNMFZDNQ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|