C15H16Cl2FN3O2 — CID 17292360
N'-(2-chloro-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]ethane-1,2-diamine;hydrochloride (PubChem CID 17292360) has the molecular formula C15H16Cl2FN3O2 and a molecular weight of 360.22 g/mol. Its IUPAC name is N'-(2-chloro-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-(2-chloro-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17292360 |
| Molecular Formula | C15H16Cl2FN3O2 |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N'-(2-chloro-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(NCCNCc2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C15H15ClFN3O2.ClH/c16-14-9-13(20(21)22)5-6-15(14)19-8-7-18-10-11-1-3-12(17)4-2-11;/h1-6,9,18-19H,7-8,10H2;1H |
| InChIKey | FEWUAWJLVKGRLM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|