C15H17ClFN3O2 — CID 17291539
N-[(4-fluorophenyl)methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 17291539) has the molecular formula C15H17ClFN3O2 and a molecular weight of 325.77 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N-[(4-fluorophenyl)methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17291539 |
| Molecular Formula | C15H17ClFN3O2 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(NCCNCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H16FN3O2.ClH/c16-13-3-1-12(2-4-13)11-17-9-10-18-14-5-7-15(8-6-14)19(20)21;/h1-8,17-18H,9-11H2;1H |
| InChIKey | CLHPSZDXGVLUAF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|