C23H20Cl2FN3O5 — CID 89428139
2-(2-chloro-4-nitrophenyl)acetaldehyde;2-(2-chloro-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]ethanamine (PubChem CID 89428139) has the molecular formula C23H20Cl2FN3O5 and a molecular weight of 508.33 g/mol. Its IUPAC name is 2-(2-chloro-4-nitrophenyl)acetaldehyde;2-(2-chloro-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]ethanamine.
| Compound Name | 2-(2-chloro-4-nitrophenyl)acetaldehyde;2-(2-chloro-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 89428139 |
| Molecular Formula | C23H20Cl2FN3O5 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2-(2-chloro-4-nitrophenyl)acetaldehyde;2-(2-chloro-4-nitrophenyl)-N-[(4-fluorophenyl)methyl]ethanamine |
| SMILES | O=CCc1ccc([N+](=O)[O-])cc1Cl.O=[N+]([O-])c1ccc(CCNCc2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C15H14ClFN2O2.C8H6ClNO3/c16-15-9-14(19(20)21)6-3-12(15)7-8-18-10-11-1-4-13(17)5-2-11;9-8-5-7(10(12)13)2-1-6(8)3-4-11/h1-6,9,18H,7-8,10H2;1-2,4-5H,3H2 |
| InChIKey | XISHHPAEXCPHQA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|