C28H34FN2O4PS — CID 123241409
3-[[4-[N-[2-(3,4-dimethylphenyl)sulfanyl-2-(3-fluorophenyl)ethoxy]-C-methylcarbonimidoyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 123241409) has the molecular formula C28H34FN2O4PS and a molecular weight of 544.63 g/mol. Its IUPAC name is 3-[[4-[N-[2-(3,4-dimethylphenyl)sulfanyl-2-(3-fluorophenyl)ethoxy]-C-methylcarbonimidoyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[N-[2-(3,4-dimethylphenyl)sulfanyl-2-(3-fluorophenyl)ethoxy]-C-methylcarbonimidoyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 123241409 |
| Molecular Formula | C28H34FN2O4PS |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 3-[[4-[N-[2-(3,4-dimethylphenyl)sulfanyl-2-(3-fluorophenyl)ethoxy]-C-methylcarbonimidoyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | CC(=NOCC(Sc1ccc(C)c(C)c1)c1cccc(F)c1)c1ccc(CNCCCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C28H34FN2O4PS/c1-20-8-13-27(16-21(20)2)37-28(25-6-4-7-26(29)17-25)19-35-31-22(3)24-11-9-23(10-12-24)18-30-14-5-15-36(32,33)34/h4,6-13,16-17,28,30H,5,14-15,18-19H2,1-3H3,(H2,32,33,34) |
| InChIKey | BMSNILNAWROLDR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|